Aliquat 336
From Wikipedia, the free encyclopedia
| Aliquat 336 | |
|---|---|
| Image:Aliquat 336.png | |
| General | |
| Systematic name | N-Methyl-N,N-dioctyloctan-1-aminium chloride |
| Other names | Tricaprylmethylammonium chloride, Methyltrioctylammonium chloride |
| Molecular formula | C25H54ClN |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(C)CCCCCCCC.[Cl-] |
| Molar mass | 404.16 g/mol |
| Appearance | Colorless viscous liquid |
| CAS number | [63393-96-4] |
| Properties | |
| Density and phase | 0.884 g/cm³, ? |
| Solubility in water | ? g/100 ml (?°C) |
| Melting point | -20.0°C (253.15 K) |
| Boiling point | 225 °C (498.15 K) |
| Viscosity | 1500 Pa.s at 30 °C |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | ? |
| NFPA 704 | |
| Flash point | 113 °C (closed cup) |
| R/S statement | R: 22-38-41-50/53 S: 26-39-60-61 |
| RTECS number | UZ2997500 |
| Supplementary data page | |
| Structure and properties | n, εr, etc. |
| Thermodynamic data | Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related | Aliquat 100, Aliquat 134, Aliquat 175, Aliquat HTA-1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25°C, 100 kPa) Infobox disclaimer and references | |
Aliquat® 336 (trademark of Henkel Corp.) is a mixture of C8 (octyl) and C10 (capryl) chains with C8 predominating. It is a quaternary ammonium salt used as a phase transfer catalyst and metal extraction reagent.
[edit] External links
 | This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
