Thiocarbanilide
From Wikipedia, the free encyclopedia
| Thiocarbanilide | |
|---|---|
| Image:Thiocarbanilide.jpg | |
| IUPAC name | 1,3-diphenylthiourea |
| Chemical formula | C13H12N2S |
| Appearance | White powder |
| Molecular mass | 228.314 g/mol |
| CAS number | [102-08-9] |
| Density | x.xxx g/cm3 |
| Melting point | 148 - 155 °C |
| Boiling point | decomposes |
| Specific gravity | 1.32 |
| NFPA 704 | |
| SMILES | C1=CC=C(C=C1)NC(=S)NC2=CC=CC=C2 |
| Disclaimer and references | |
Thiocarbanilide is an organic chemical compound. It is also known as sym-Diphenylthiourea, Diphenylthiourea, Diphenylurea, 1,3-diphenyl-2-thiourea, DPTU, 1,3-diphenylthiourea, and Sulfocarbanilide.
[edit] Uses
Thiocarbanilide is commonly used as a vulcanization accelerator for rubber, and as a stabilizer for PVC and PVDC.
[edit] Toxicology
Oral, rat: LD50 = 50 mg/kg.
[edit] External links


